CAS 25487-66-5 appears in our catalog under these names: 3-Carboxyphenylboronic Acid, >95% (HPLC), 3–Carboxyphenylboronic acid(contains varying amounts of Anhydride), 3-Carboxyphenylboronic Acid (contains varying amounts of Anhydride), 3-Carboxyphenylboronic acid, 3-Carboxyphenylboronic acid, 97%. Offered by: TRC, GLPBio, TCI, Biosynth, Thermo Scientific (Acros). Available pack sizes: 1g, 2,5g, 500mg, 100g, 500g, 5g, 50g, 25g.
3-boronobenzoic acid (CAS 25487-66-5) is a chemical compound with the molecular formula C7H7BO4 and a molecular weight of 165.94 g/mol. IUPAC name: 3-boronobenzoic acid. InChIKey: DBVFWZMQJQMJCB-UHFFFAOYSA-N.
| Molecular formula | C7H7BO4 |
|---|---|
| Molecular weight | 165.94 g/mol |
| IUPAC name | 3-boronobenzoic acid |
| InChIKey | DBVFWZMQJQMJCB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)O)(O)O |
Computed by PubChem (NCBI)