Products 1734-00-5

CAS 1734-00-5 is the registry number for 3-Hydroxy-2-naphthalenecarbonyl chloride, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

3-hydroxynaphthalene-2-carbonyl chloride (CAS 1734-00-5) is a chemical compound with the molecular formula C11H7ClO2 and a molecular weight of 206.62 g/mol. IUPAC name: 3-hydroxynaphthalene-2-carbonyl chloride. InChIKey: RLCZBUOZNFAZLK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7ClO2
Molecular weight206.62 g/mol
IUPAC name3-hydroxynaphthalene-2-carbonyl chloride
InChIKeyRLCZBUOZNFAZLK-UHFFFAOYSA-N
SMILESC1=CC=C2C=C(C(=CC2=C1)C(=O)Cl)O

Computed by PubChem (NCBI)