CAS 16650-53-6 appears in our catalog under these names: 6-Chloronaphthalene-1-carboxylic acid, 6-Chloro-1-naphthoic acid, 97%, 6-Chloro-1-naphthalenecarboxylic acid, 95%. Offered by: Biosynth, AmBeed, Chemat. Available pack sizes: 50mg, 0,5g, 1g, 100mg, 250mg, 5g, 10g.
6-chloronaphthalene-1-carboxylic acid (CAS 16650-53-6) is a chemical compound with the molecular formula C11H7ClO2 and a molecular weight of 206.62 g/mol. IUPAC name: 6-chloronaphthalene-1-carboxylic acid. InChIKey: SSQYFWFMNFKLBB-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO2 |
|---|---|
| Molecular weight | 206.62 g/mol |
| IUPAC name | 6-chloronaphthalene-1-carboxylic acid |
| InChIKey | SSQYFWFMNFKLBB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Cl)C(=C1)C(=O)O |
Computed by PubChem (NCBI)