CAS 22078-59-7 appears in our catalog under these names: 5-(3-Chlorophenyl)furan-2-carbaldehyde, 98%, 5–(3–Chlorophenyl)furfural, 2-Furancarboxaldehyde, 5-(3-chlorophenyl)-, 95%, 95%, 5-(3-chlorophenyl)-2-furaldehyde. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 1g, 250mg.
5-(3-chlorophenyl)furan-2-carbaldehyde (CAS 22078-59-7) is a chemical compound with the molecular formula C11H7ClO2 and a molecular weight of 206.62 g/mol. IUPAC name: 5-(3-chlorophenyl)furan-2-carbaldehyde. InChIKey: FIGLPGGFAIZKFQ-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO2 |
|---|---|
| Molecular weight | 206.62 g/mol |
| IUPAC name | 5-(3-chlorophenyl)furan-2-carbaldehyde |
| InChIKey | FIGLPGGFAIZKFQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC=C(O2)C=O |
Computed by PubChem (NCBI)