4-Chloro-2,2'-bipyridine, 95%
cas: 14162-94-8 — see every product listed under this CAS number, including other names
4-Chloro-2,2'-bipyridine, 95% (CAS 14162-94-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 25g, 250mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A270810-100mg |
| cas | 14162-94-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 409.31 Pln | |
| Ambeed | 25g | 1638.62 Pln | |
| BLDpharm | 100mg | 158.86 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 208.84 Pln | |
| BLDpharm | 5g | 436.54 Pln | |
| BLDpharm | 25g | 1758.29 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-chloro-2-pyridin-2-ylpyridine (CAS 14162-94-8) is a chemical compound with the molecular formula C10H7ClN2 and a molecular weight of 190.63 g/mol. IUPAC name: 4-chloro-2-pyridin-2-ylpyridine. InChIKey: IXEGJZGCPOORDR-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2 |
|---|---|
| Molecular weight | 190.63 g/mol |
| IUPAC name | 4-chloro-2-pyridin-2-ylpyridine |
| InChIKey | IXEGJZGCPOORDR-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC=CC(=C2)Cl |
Computed by PubChem (NCBI)