CAS 14162-94-8 appears in our catalog under these names: 4-Chloro-2,2'-bipyridine, 98%, 4–Chloro–2,2'–bipyridine, 4-Chloro-2,2'-bipyridine 95%, 4-chloro-2,2'-bipyridine, 97%, 97%, 4-Chloro-2,2'-bipyridine, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg.
4-chloro-2-pyridin-2-ylpyridine (CAS 14162-94-8) is a chemical compound with the molecular formula C10H7ClN2 and a molecular weight of 190.63 g/mol. IUPAC name: 4-chloro-2-pyridin-2-ylpyridine. InChIKey: IXEGJZGCPOORDR-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2 |
|---|---|
| Molecular weight | 190.63 g/mol |
| IUPAC name | 4-chloro-2-pyridin-2-ylpyridine |
| InChIKey | IXEGJZGCPOORDR-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC=CC(=C2)Cl |
Computed by PubChem (NCBI)