CAS 13040-77-2 appears in our catalog under these names: 6-Chloro-2,2'-bipyridine, 95%, 6–Chloro–2,2’–bipyridine, 6-Chloro-2,2'-bipyridine, 6-Chloro-2,2'-bipyridine 95%, 6-Chloro-2,2'-bipyridine, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g, 25g, 100g.
2-chloro-6-pyridin-2-ylpyridine (CAS 13040-77-2) is a chemical compound with the molecular formula C10H7ClN2 and a molecular weight of 190.63 g/mol. IUPAC name: 2-chloro-6-pyridin-2-ylpyridine. InChIKey: XRCUTZKABNKOEY-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2 |
|---|---|
| Molecular weight | 190.63 g/mol |
| IUPAC name | 2-chloro-6-pyridin-2-ylpyridine |
| InChIKey | XRCUTZKABNKOEY-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC(=CC=C2)Cl |
Computed by PubChem (NCBI)