CAS 1214335-54-2 is the registry number for 4-Chloro-2,4'-bipyridine, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-2-pyridin-4-ylpyridine (CAS 1214335-54-2) is a chemical compound with the molecular formula C10H7ClN2 and a molecular weight of 190.63 g/mol. IUPAC name: 4-chloro-2-pyridin-4-ylpyridine. InChIKey: KEJMRFQAMHFLOG-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2 |
|---|---|
| Molecular weight | 190.63 g/mol |
| IUPAC name | 4-chloro-2-pyridin-4-ylpyridine |
| InChIKey | KEJMRFQAMHFLOG-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NC=CC(=C2)Cl |
Computed by PubChem (NCBI)