CAS 79739-22-3 appears in our catalog under these names: 6-Chloro-3,4'-bipyridine, 95%, 6-Chloro-3,4'-bipyridine, 97%, 6–Chloro–3,4′–bipyridine, 6-Chloro-3,4'bipyridine, 6-Chloro-3,4'-bipyridine, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 100mg, 10g, 250mg, 1g, 500mg, 0,5g, 50mg.
2-chloro-5-pyridin-4-ylpyridine (CAS 79739-22-3) is a chemical compound with the molecular formula C10H7ClN2 and a molecular weight of 190.63 g/mol. IUPAC name: 2-chloro-5-pyridin-4-ylpyridine. InChIKey: AZESIBFJNSNUBT-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2 |
|---|---|
| Molecular weight | 190.63 g/mol |
| IUPAC name | 2-chloro-5-pyridin-4-ylpyridine |
| InChIKey | AZESIBFJNSNUBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C2=CC=NC=C2)Cl |
Computed by PubChem (NCBI)