cas: 2377606-42-1 — see every product listed under this CAS number, including other names
4-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 97% (CAS 2377606-42-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691822-250MG |
| cas | 2377606-42-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1153.78 Pln | |
| Fluorochem | 5g | 4381.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 2377606-42-1) is a chemical compound with the molecular formula C13H16BClO4 and a molecular weight of 282.53 g/mol. IUPAC name: 4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: XLOCLHOUEODTBY-UHFFFAOYSA-N.
| Molecular formula | C13H16BClO4 |
|---|---|
| Molecular weight | 282.53 g/mol |
| IUPAC name | 4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | XLOCLHOUEODTBY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)