CAS 890839-31-3 appears in our catalog under these names: 4-Carboxy-3-chlorophenylboronic acid pinacol ester, 4-Carboxy-3-chlorophenylboronic acid, pinacol ester, 96%, 5-Chloro-4-methoxycarbonyl-2-fluorophenylboronic acid pinacol ester, 98%, 4-Carboxy-3-chlorophenylboronic acid, pinacol ester, 95-<97%, 4-Carboxy-3-chlorophenylboronic acid, pinacol ester, ≥97-<99%. Offered by: Biosynth, Combi-blocks, Hoffman Fine Chemicals, Ambeed, Chemat. Available pack sizes: 0,5g, 5g, 25g, 1g, 10g, 50g, 100g, 200g.
2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 890839-31-3) is a chemical compound with the molecular formula C13H16BClO4 and a molecular weight of 282.53 g/mol. IUPAC name: 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: MFHUTQFPFZUQCI-UHFFFAOYSA-N.
| Molecular formula | C13H16BClO4 |
|---|---|
| Molecular weight | 282.53 g/mol |
| IUPAC name | 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | MFHUTQFPFZUQCI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)