Products 936728-21-1

CAS 936728-21-1 is the registry number for 3-Carboxy-4-chlorophenylboronic acid pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 936728-21-1) is a chemical compound with the molecular formula C13H16BClO4 and a molecular weight of 282.53 g/mol. IUPAC name: 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: VUWPWVQNFRBOLI-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16BClO4
Molecular weight282.53 g/mol
IUPAC name2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid
InChIKeyVUWPWVQNFRBOLI-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)Cl)C(=O)O

Computed by PubChem (NCBI)