CAS 918331-73-4 appears in our catalog under these names: 5-Carboxy-2-chlorophenylboronic acid, pinacol ester, 97%, 4-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid 97%, 5-Carboxy-2-chlorophenylboronic acid, pinacol ester, 97%, 97%, 4-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg, 100g, 100mg.
4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 918331-73-4) is a chemical compound with the molecular formula C13H16BClO4 and a molecular weight of 282.53 g/mol. IUPAC name: 4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: MRHDRTNQFRBXFI-UHFFFAOYSA-N.
| Molecular formula | C13H16BClO4 |
|---|---|
| Molecular weight | 282.53 g/mol |
| IUPAC name | 4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | MRHDRTNQFRBXFI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)