CAS 2096331-90-5 appears in our catalog under these names: 3-Carboxy-2-chlorophenylboronic acid, pinacol ester, 98%, 2-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 2096331-90-5) is a chemical compound with the molecular formula C13H16BClO4 and a molecular weight of 282.53 g/mol. IUPAC name: 2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: PYLCRLCEYRXOOJ-UHFFFAOYSA-N.
| Molecular formula | C13H16BClO4 |
|---|---|
| Molecular weight | 282.53 g/mol |
| IUPAC name | 2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | PYLCRLCEYRXOOJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)