cas: 18349-11-6 — see every product listed under this CAS number, including other names
4-Chloro-2-fluoro-5-nitrotoluene 98% (CAS 18349-11-6) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A181145-1000g |
| cas | 18349-11-6 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 4859.31 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 281.38 Pln | |
| Ambeed | 100g | 832.06 Pln | |
| Ambeed | 500g | 2740.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A181145 |
1-chloro-5-fluoro-4-methyl-2-nitrobenzene (CAS 18349-11-6) is a chemical compound with the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. IUPAC name: 1-chloro-5-fluoro-4-methyl-2-nitrobenzene. InChIKey: SJDPAVRCQNFVDM-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO2 |
|---|---|
| Molecular weight | 189.57 g/mol |
| IUPAC name | 1-chloro-5-fluoro-4-methyl-2-nitrobenzene |
| InChIKey | SJDPAVRCQNFVDM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)