cas: 5551-11-1 — see every product listed under this CAS number, including other names
4-Chloro-2-nitrobenzaldehyde 98% (CAS 5551-11-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A153734-250mg |
| cas | 5551-11-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 259.12 Pln | |
| Ambeed | 25g | 414.88 Pln | |
| Ambeed | 100g | 1405.00 Pln | |
| Ambeed | 500g | 5410.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A153734 |
4-chloro-2-nitrobenzaldehyde (CAS 5551-11-1) is a chemical compound with the molecular formula C7H4ClNO3 and a molecular weight of 185.56 g/mol. IUPAC name: 4-chloro-2-nitrobenzaldehyde. InChIKey: MZPNQUMLOFWSEK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3 |
|---|---|
| Molecular weight | 185.56 g/mol |
| IUPAC name | 4-chloro-2-nitrobenzaldehyde |
| InChIKey | MZPNQUMLOFWSEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)