cas: 5551-11-1 — see every product listed under this CAS number, including other names
Benzaldehyde, 4-chloro-2-nitro-, 98%, 98% (CAS 5551-11-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114L4X-250mg |
| cas | 5551-11-1 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 170.00 Pln | |
| Chemat | 25g | 328.40 Pln | |
| Chemat | 100g | 1072.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-chloro-2-nitrobenzaldehyde (CAS 5551-11-1) is a chemical compound with the molecular formula C7H4ClNO3 and a molecular weight of 185.56 g/mol. IUPAC name: 4-chloro-2-nitrobenzaldehyde. InChIKey: MZPNQUMLOFWSEK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3 |
|---|---|
| Molecular weight | 185.56 g/mol |
| IUPAC name | 4-chloro-2-nitrobenzaldehyde |
| InChIKey | MZPNQUMLOFWSEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)