cas: 37777-71-2 — see every product listed under this CAS number, including other names
4-Chloro-2-nitrophenylacetic acid, 95% (CAS 37777-71-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F227870-5G |
| cas | 37777-71-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 25g | 372.80 Pln | |
| Fluorochem | 100g | 1158.98 Pln | |
| Fluorochem | 500g | 4662.96 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-chloro-2-nitrophenyl)acetic acid (CAS 37777-71-2) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 2-(4-chloro-2-nitrophenyl)acetic acid. InChIKey: FLZUSUKBKOZJLG-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 2-(4-chloro-2-nitrophenyl)acetic acid |
| InChIKey | FLZUSUKBKOZJLG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)