cas: 918331-73-4 — see every product listed under this CAS number, including other names
4-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 97% (CAS 918331-73-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F622980-5G |
| cas | 918331-73-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1049.65 Pln | |
| Fluorochem | 1g | 284.29 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 918331-73-4) is a chemical compound with the molecular formula C13H16BClO4 and a molecular weight of 282.53 g/mol. IUPAC name: 4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: MRHDRTNQFRBXFI-UHFFFAOYSA-N.
| Molecular formula | C13H16BClO4 |
|---|---|
| Molecular weight | 282.53 g/mol |
| IUPAC name | 4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | MRHDRTNQFRBXFI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)