cas: 874219-45-1 — see every product listed under this CAS number, including other names
4-Chloro-3-(methoxycarbonyl)phenylboronic Acid (contains varying amounts of Anhydride), >97.0%(T) (CAS 874219-45-1) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C3320-200MG |
| cas | 874219-45-1 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 98.68 Pln | |
| TCI | 1g | 344.54 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(T) |
(4-chloro-3-methoxycarbonylphenyl)boronic acid (CAS 874219-45-1) is a chemical compound with the molecular formula C8H8BClO4 and a molecular weight of 214.41 g/mol. IUPAC name: (4-chloro-3-methoxycarbonylphenyl)boronic acid. InChIKey: YEPWHDGFBVDINZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BClO4 |
|---|---|
| Molecular weight | 214.41 g/mol |
| IUPAC name | (4-chloro-3-methoxycarbonylphenyl)boronic acid |
| InChIKey | YEPWHDGFBVDINZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)C(=O)OC)(O)O |
Computed by PubChem (NCBI)