cas: 202982-66-9 — see every product listed under this CAS number, including other names
4-Chloro-3-fluorocinnamic acid 95% (E) (CAS 202982-66-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A280894-1g |
| cas | 202982-66-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 437.12 Pln | |
| Ambeed | 10g | 798.69 Pln |
| purity | 95% (E) |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A280894 |
(E)-3-(4-chloro-3-fluorophenyl)prop-2-enoic acid (CAS 202982-66-9) is a chemical compound with the molecular formula C9H6ClFO2 and a molecular weight of 200.59 g/mol. IUPAC name: (E)-3-(4-chloro-3-fluorophenyl)prop-2-enoic acid. InChIKey: MNELKRQRBRYHBV-DUXPYHPUSA-N.
| Molecular formula | C9H6ClFO2 |
|---|---|
| Molecular weight | 200.59 g/mol |
| IUPAC name | (E)-3-(4-chloro-3-fluorophenyl)prop-2-enoic acid |
| InChIKey | MNELKRQRBRYHBV-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)O)F)Cl |
Computed by PubChem (NCBI)