CAS 1273653-86-3 appears in our catalog under these names: 5-Chloro-8-fluorochroman-4-one, 95%, 5–Chloro–8–fluorochroman–4–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
5-chloro-8-fluoro-2,3-dihydrochromen-4-one (CAS 1273653-86-3) is a chemical compound with the molecular formula C9H6ClFO2 and a molecular weight of 200.59 g/mol. IUPAC name: 5-chloro-8-fluoro-2,3-dihydrochromen-4-one. InChIKey: LJRZQDARYMVTSS-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFO2 |
|---|---|
| Molecular weight | 200.59 g/mol |
| IUPAC name | 5-chloro-8-fluoro-2,3-dihydrochromen-4-one |
| InChIKey | LJRZQDARYMVTSS-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC(=C2C1=O)Cl)F |
Computed by PubChem (NCBI)