CAS 202982-66-9 appears in our catalog under these names: 4-Chloro-3-fluorocinnamic acid, 95%, 4-Chloro-3-fluorocinnamic acid, 95% (E), 95% (E). Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
(E)-3-(4-chloro-3-fluorophenyl)prop-2-enoic acid (CAS 202982-66-9) is a chemical compound with the molecular formula C9H6ClFO2 and a molecular weight of 200.59 g/mol. IUPAC name: (E)-3-(4-chloro-3-fluorophenyl)prop-2-enoic acid. InChIKey: MNELKRQRBRYHBV-DUXPYHPUSA-N.
| Molecular formula | C9H6ClFO2 |
|---|---|
| Molecular weight | 200.59 g/mol |
| IUPAC name | (E)-3-(4-chloro-3-fluorophenyl)prop-2-enoic acid |
| InChIKey | MNELKRQRBRYHBV-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)O)F)Cl |
Computed by PubChem (NCBI)