CAS 392-22-3 appears in our catalog under these names: 2-Chloro-6-fluorocinnamic acid, 95%, 2-Chloro-6-fluorocinnamic acid, 2-Chloro-6-fluorocinnamic acid, 98%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g, 10000mg.
(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoic acid (CAS 392-22-3) is a chemical compound with the molecular formula C9H6ClFO2 and a molecular weight of 200.59 g/mol. IUPAC name: (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoic acid. InChIKey: NDWALECYVLNBQG-SNAWJCMRSA-N.
| Molecular formula | C9H6ClFO2 |
|---|---|
| Molecular weight | 200.59 g/mol |
| IUPAC name | (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoic acid |
| InChIKey | NDWALECYVLNBQG-SNAWJCMRSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)