Products 936366-61-9
CAS 936366-61-9 appears in our catalog under these names: 3-Chloro-5-fluorocinnamic acid, 95%, 3-Chloro-5-fluorocinnamic acid, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
(E)-3-(3-chloro-5-fluorophenyl)prop-2-enoic acid (CAS 936366-61-9) is a chemical compound with the molecular formula C9H6ClFO2 and a molecular weight of 200.59 g/mol. IUPAC name: (E)-3-(3-chloro-5-fluorophenyl)prop-2-enoic acid. InChIKey: XHRJSHYRAZWUNA-OWOJBTEDSA-N.
| Molecular formula | C9H6ClFO2 |
|---|---|
| Molecular weight | 200.59 g/mol |
| IUPAC name | (E)-3-(3-chloro-5-fluorophenyl)prop-2-enoic acid |
| InChIKey | XHRJSHYRAZWUNA-OWOJBTEDSA-N |
| SMILES | C1=C(C=C(C=C1F)Cl)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Chloro-5-fluorocinnamic acid, 3-(3-Chloro-5-fluorophenyl)acrylic acid, (E)-3-(3-chloro-5-fluorophenyl)prop-2-enoic acid, (2E)-3-(3-chloro-5-fluorophenyl)prop-2-enoic acid, 3-(3-Chloro-5-fluorophenyl)acrylicacid, 3-(3-chloro-5-fluorophenyl)prop-2-enoic acid, (E)-3-(3-chloro-5-fluoro-phenyl)prop-2-enoic acid