cas: 1774905-24-6 — see every product listed under this CAS number, including other names
4-Chloro-3H-spiro[isobenzofuran-1,4'-piperidine] hydrochloride 97% (CAS 1774905-24-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A740838-100mg |
| cas | 1774905-24-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 3218.38 Pln | |
| Ambeed | 250mg | 6361.19 Pln | |
| Ambeed | 1g | 15800.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A740838 |
7-chlorospiro[1H-2-benzofuran-3,4'-piperidine];hydrochloride (CAS 1774905-24-6) is a chemical compound with the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. IUPAC name: 7-chlorospiro[1H-2-benzofuran-3,4'-piperidine];hydrochloride. InChIKey: KWVJVASQTCNQJI-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | 7-chlorospiro[1H-2-benzofuran-3,4'-piperidine];hydrochloride |
| InChIKey | KWVJVASQTCNQJI-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(CO2)C(=CC=C3)Cl.Cl |
Computed by PubChem (NCBI)