cas: 40493-18-3 — see every product listed under this CAS number, including other names
4-Chloro-5,6,7,8-tetrahydrobenzo[4,5]thieno[2,3-d]pyrimidine 98% (CAS 40493-18-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A424285-250mg |
| cas | 40493-18-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 1221.44 Pln | |
| Ambeed | 10g | 2111.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A424285 |
4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (CAS 40493-18-3) is a chemical compound with the molecular formula C10H9ClN2S and a molecular weight of 224.71 g/mol. IUPAC name: 4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine. InChIKey: PRNJDUCSVXTOTN-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2S |
|---|---|
| Molecular weight | 224.71 g/mol |
| IUPAC name | 4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| InChIKey | PRNJDUCSVXTOTN-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(S2)N=CN=C3Cl |
Computed by PubChem (NCBI)