cas: 40493-18-3 — see every product listed under this CAS number, including other names
4-Chloro-5,6,7,8-tetrahydrobenzo[4,5]thieno[2,3-d]pyrimidine, 95% (CAS 40493-18-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F021472-1G |
| cas | 40493-18-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 5g | 1112.13 Pln | |
| Fluorochem | 10g | 2038.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (CAS 40493-18-3) is a chemical compound with the molecular formula C10H9ClN2S and a molecular weight of 224.71 g/mol. IUPAC name: 4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine. InChIKey: PRNJDUCSVXTOTN-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2S |
|---|---|
| Molecular weight | 224.71 g/mol |
| IUPAC name | 4-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| InChIKey | PRNJDUCSVXTOTN-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(S2)N=CN=C3Cl |
Computed by PubChem (NCBI)