Products 6972-36-7
CAS 6972-36-7 appears in our catalog under these names: 5-Amino-2-chloro-4,6-dimethylnicotinonitrile, 95%, 5-Amino-2-chloro-4,6-dimethylpyridine-3-carbonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 50mg.
5-amino-2-chloro-4,6-dimethylpyridine-3-carbonitrile (CAS 6972-36-7) is a chemical compound with the molecular formula C8H8ClN3 and a molecular weight of 181.62 g/mol. IUPAC name: 5-amino-2-chloro-4,6-dimethylpyridine-3-carbonitrile. InChIKey: RPRGFOOFJMWOOI-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 5-amino-2-chloro-4,6-dimethylpyridine-3-carbonitrile |
| InChIKey | RPRGFOOFJMWOOI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=C1N)C)Cl)C#N |
Computed by PubChem (NCBI)