cas: 897445-45-3 — see every product listed under this CAS number, including other names
4-Chloro-6-(4-chlorophenyl)pyrimidine, 95-<97% (CAS 897445-45-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC1848-95-97-1g |
| cas | 897445-45-3 |
| size | 1g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 1g | 3536.28 Pln | |
| Hoffman Fine Chemicals | 2,5g | 5954.30 Pln | |
| Hoffman Fine Chemicals | 5g | 9342.08 Pln | |
| Hoffman Fine Chemicals | 10g | 14765.08 Pln | |
| Hoffman Fine Chemicals | 25g | 29215.78 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
4-chloro-6-(4-chlorophenyl)pyrimidine (CAS 897445-45-3) is a chemical compound with the molecular formula C10H6Cl2N2 and a molecular weight of 225.07 g/mol. IUPAC name: 4-chloro-6-(4-chlorophenyl)pyrimidine. InChIKey: MKNGXRJNEVAVAS-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 4-chloro-6-(4-chlorophenyl)pyrimidine |
| InChIKey | MKNGXRJNEVAVAS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NC=N2)Cl)Cl |
Computed by PubChem (NCBI)