cas: 544-47-8 — see every product listed under this CAS number, including other names
4-Chlorobenzyl carbamimidothioate hydrochloride, 98%, 98% (CAS 544-47-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114U74-100mg |
| cas | 544-47-8 |
| size | 100mg |
| availability | 42g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 25g | 1456.40 Pln | |
| Chemat | 10g | 683.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-chlorophenyl)methyl carbamimidothioate;hydrochloride (CAS 544-47-8) is a chemical compound with the molecular formula C8H10Cl2N2S and a molecular weight of 237.15 g/mol. IUPAC name: (4-chlorophenyl)methyl carbamimidothioate;hydrochloride. InChIKey: QAVHMIYSTFZJAU-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2S |
|---|---|
| Molecular weight | 237.15 g/mol |
| IUPAC name | (4-chlorophenyl)methyl carbamimidothioate;hydrochloride |
| InChIKey | QAVHMIYSTFZJAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CSC(=N)N)Cl.Cl |
Computed by PubChem (NCBI)