CAS 32770-99-3 appears in our catalog under these names: 5-Amino-2-methylbenzothiazole dihydrochloride, 95%, 5-Amino-2-methylbenzothiazole dihydrochloride, 97%, 5-AMINO-2-METHYLBENZOTHIAZOLE DIHYDROCH&, 2-Methylbenzo[d]thiazol-5-amine dihydrochloride, 98%, 98%, 2-Methyl-1,3-benzothiazol-5-amine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
2-methyl-1,3-benzothiazol-5-amine;dihydrochloride (CAS 32770-99-3) is a chemical compound with the molecular formula C8H10Cl2N2S and a molecular weight of 237.15 g/mol. IUPAC name: 2-methyl-1,3-benzothiazol-5-amine;dihydrochloride. InChIKey: ZNIGVBCUUZGYDU-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2S |
|---|---|
| Molecular weight | 237.15 g/mol |
| IUPAC name | 2-methyl-1,3-benzothiazol-5-amine;dihydrochloride |
| InChIKey | ZNIGVBCUUZGYDU-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=CC(=C2)N.Cl.Cl |
Computed by PubChem (NCBI)