cas: 544-47-8 — see every product listed under this CAS number, including other names
4-CHLOROBENZYL CARBAMIMIDOTHIOATE HCL, 98% (CAS 544-47-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F306206-5G |
| cas | 544-47-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 893.45 Pln | |
| Fluorochem | 25g | 3392.57 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(4-chlorophenyl)methyl carbamimidothioate;hydrochloride (CAS 544-47-8) is a chemical compound with the molecular formula C8H10Cl2N2S and a molecular weight of 237.15 g/mol. IUPAC name: (4-chlorophenyl)methyl carbamimidothioate;hydrochloride. InChIKey: QAVHMIYSTFZJAU-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2S |
|---|---|
| Molecular weight | 237.15 g/mol |
| IUPAC name | (4-chlorophenyl)methyl carbamimidothioate;hydrochloride |
| InChIKey | QAVHMIYSTFZJAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CSC(=N)N)Cl.Cl |
Computed by PubChem (NCBI)