CAS 544-47-8 appears in our catalog under these names: S-(4-Chlorobenzyl)isothiouronium chloride, 98%, MP265/ 99.55% (existing batch purity), MP265, 4-Chlorobenzyl carbamimidothioate hydrochloride, 98%, 98%, MP265, 99.50%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25g, 5g, 1g, 5mg, 10mg, 25mg, 50mg, 100mg.
(4-chlorophenyl)methyl carbamimidothioate;hydrochloride (CAS 544-47-8) is a chemical compound with the molecular formula C8H10Cl2N2S and a molecular weight of 237.15 g/mol. IUPAC name: (4-chlorophenyl)methyl carbamimidothioate;hydrochloride. InChIKey: QAVHMIYSTFZJAU-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2S |
|---|---|
| Molecular weight | 237.15 g/mol |
| IUPAC name | (4-chlorophenyl)methyl carbamimidothioate;hydrochloride |
| InChIKey | QAVHMIYSTFZJAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CSC(=N)N)Cl.Cl |
Computed by PubChem (NCBI)