CAS 3778-85-6 is the registry number for 2-Chlorobenzyl imidothiocarbamate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2-chlorophenyl)methyl carbamimidothioate;hydrochloride (CAS 3778-85-6) is a chemical compound with the molecular formula C8H10Cl2N2S and a molecular weight of 237.15 g/mol. IUPAC name: (2-chlorophenyl)methyl carbamimidothioate;hydrochloride. InChIKey: CEICVYXCGHTEIT-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2S |
|---|---|
| Molecular weight | 237.15 g/mol |
| IUPAC name | (2-chlorophenyl)methyl carbamimidothioate;hydrochloride |
| InChIKey | CEICVYXCGHTEIT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CSC(=N)N)Cl.Cl |
Computed by PubChem (NCBI)