Products 3778-85-6

CAS 3778-85-6 is the registry number for 2-Chlorobenzyl imidothiocarbamate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

(2-chlorophenyl)methyl carbamimidothioate;hydrochloride (CAS 3778-85-6) is a chemical compound with the molecular formula C8H10Cl2N2S and a molecular weight of 237.15 g/mol. IUPAC name: (2-chlorophenyl)methyl carbamimidothioate;hydrochloride. InChIKey: CEICVYXCGHTEIT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10Cl2N2S
Molecular weight237.15 g/mol
IUPAC name(2-chlorophenyl)methyl carbamimidothioate;hydrochloride
InChIKeyCEICVYXCGHTEIT-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)CSC(=N)N)Cl.Cl

Computed by PubChem (NCBI)