cas: 5152-84-1 — see every product listed under this CAS number, including other names
4-Chlorocinnoline 97% (CAS 5152-84-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A965333-100mg |
| cas | 5152-84-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 537.25 Pln | |
| Ambeed | 1g | 1032.31 Pln | |
| Ambeed | 5g | 3262.88 Pln | |
| Ambeed | 10g | 5804.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A965333 |
4-chlorocinnoline (CAS 5152-84-1) is a chemical compound with the molecular formula C8H5ClN2 and a molecular weight of 164.59 g/mol. IUPAC name: 4-chlorocinnoline. InChIKey: IJSFFUOWXQRDMS-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2 |
|---|---|
| Molecular weight | 164.59 g/mol |
| IUPAC name | 4-chlorocinnoline |
| InChIKey | IJSFFUOWXQRDMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=N2)Cl |
Computed by PubChem (NCBI)