4-Chloroimidazo[1,2-a]quinoxaline, 98%
cas: 191349-69-6 — see every product listed under this CAS number, including other names
4-Chloroimidazo[1,2-a]quinoxaline, 98% (CAS 191349-69-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A371500-100mg |
| cas | 191349-69-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 915.50 Pln | |
| Ambeed | 250mg | 1505.12 Pln | |
| Ambeed | 1g | 4019.38 Pln | |
| Chemat | 100mg | 592.40 Pln | |
| Chemat | 250mg | 1120.40 Pln | |
| Chemat | 1g | 3227.60 Pln | |
| BLDpharm | 100mg | 980.79 Pln | |
| BLDpharm | 250mg | 1613.90 Pln | |
| BLDpharm | 1g | 4324.06 Pln | |
| Fluorochem | 100mg | 1086.09 Pln | |
| Fluorochem | 250mg | 2075.33 Pln | |
| Fluorochem | 1g | 5985.41 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4-chloroimidazo[1,2-a]quinoxaline (CAS 191349-69-6) is a chemical compound with the molecular formula C10H6ClN3 and a molecular weight of 203.63 g/mol. IUPAC name: 4-chloroimidazo[1,2-a]quinoxaline. InChIKey: RYNAIJUDTQWFSL-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN3 |
|---|---|
| Molecular weight | 203.63 g/mol |
| IUPAC name | 4-chloroimidazo[1,2-a]quinoxaline |
| InChIKey | RYNAIJUDTQWFSL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(C3=NC=CN23)Cl |
Computed by PubChem (NCBI)