CAS 27191-19-1 is the registry number for 9-Chloro-[1,2,4]triazolo[3,4-a]isoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9-chloro-[1,2,4]triazolo[3,4-a]isoquinoline (CAS 27191-19-1) is a chemical compound with the molecular formula C10H6ClN3 and a molecular weight of 203.63 g/mol. IUPAC name: 9-chloro-[1,2,4]triazolo[3,4-a]isoquinoline. InChIKey: MKUVDHZFXURBRV-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN3 |
|---|---|
| Molecular weight | 203.63 g/mol |
| IUPAC name | 9-chloro-[1,2,4]triazolo[3,4-a]isoquinoline |
| InChIKey | MKUVDHZFXURBRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CN3C2=NN=C3)Cl |
Computed by PubChem (NCBI)