CAS 2617705-96-9 is the registry number for 2-(5-Chloro-1,8-naphthyridin-2-yl)acetonitrile. Offered by: TRC. Available pack sizes: 250mg.
2-(5-chloro-1,8-naphthyridin-2-yl)acetonitrile (CAS 2617705-96-9) is a chemical compound with the molecular formula C10H6ClN3 and a molecular weight of 203.63 g/mol. IUPAC name: 2-(5-chloro-1,8-naphthyridin-2-yl)acetonitrile. InChIKey: BPTIZPJQTQCKSW-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN3 |
|---|---|
| Molecular weight | 203.63 g/mol |
| IUPAC name | 2-(5-chloro-1,8-naphthyridin-2-yl)acetonitrile |
| InChIKey | BPTIZPJQTQCKSW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2N=C1CC#N)Cl |
Computed by PubChem (NCBI)