CAS 174709-48-9 is the registry number for 4-Chloro-8H-pyrrolo[3,2-g]quinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-3H-pyrrolo[3,2-g]quinazoline (CAS 174709-48-9) is a chemical compound with the molecular formula C10H6ClN3 and a molecular weight of 203.63 g/mol. IUPAC name: 4-chloro-3H-pyrrolo[3,2-g]quinazoline. InChIKey: DARXGNKZKFVAFE-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN3 |
|---|---|
| Molecular weight | 203.63 g/mol |
| IUPAC name | 4-chloro-3H-pyrrolo[3,2-g]quinazoline |
| InChIKey | DARXGNKZKFVAFE-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C1=CC3=C(NC=NC3=C2)Cl |
Computed by PubChem (NCBI)