CAS 1505396-81-5 is the registry number for 5-Chloropyrazolo(1,5-a)quinazoline, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-chloropyrazolo[1,5-a]quinazoline (CAS 1505396-81-5) is a chemical compound with the molecular formula C10H6ClN3 and a molecular weight of 203.63 g/mol. IUPAC name: 5-chloropyrazolo[1,5-a]quinazoline. InChIKey: KWIZLLPTFZNCMK-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN3 |
|---|---|
| Molecular weight | 203.63 g/mol |
| IUPAC name | 5-chloropyrazolo[1,5-a]quinazoline |
| InChIKey | KWIZLLPTFZNCMK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC3=CC=NN23)Cl |
Computed by PubChem (NCBI)