cas: 452972-15-5 — see every product listed under this CAS number, including other names
4-Chloropyridine-3-boronic acid pinacol ester, 97% (CAS 452972-15-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219435-5G |
| cas | 452972-15-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 690.40 Pln | |
| Fluorochem | 10g | 1195.43 Pln | |
| Fluorochem | 25g | 2330.45 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 452972-15-5) is a chemical compound with the molecular formula C11H15BClNO2 and a molecular weight of 239.51 g/mol. IUPAC name: 4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: KTLJNRVZMVZXMR-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO2 |
|---|---|
| Molecular weight | 239.51 g/mol |
| IUPAC name | 4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | KTLJNRVZMVZXMR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CN=C2)Cl |
Computed by PubChem (NCBI)