Products 57334-36-8
CAS 57334-36-8 appears in our catalog under these names: 4–Chloroquinolin–8–ol, 4-Chloro-8-quinolinol, 4-Chloroquinolin-8-ol 95%, 4-Chloroquinolin-8-ol, 98.95%, 4-Chloroquinolin-8-ol, 98%. Offered by: GLPBio, Biosynth, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 1000mg, 250mg, 1g, 5g, 500 mg, 1 g, 250 mg.
4-chloroquinolin-8-ol (CAS 57334-36-8) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 4-chloroquinolin-8-ol. InChIKey: DEPRJVQVGXOXRN-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 4-chloroquinolin-8-ol |
| InChIKey | DEPRJVQVGXOXRN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C(=C1)O)Cl |
Computed by PubChem (NCBI)