cas: 3272-08-0 — see every product listed under this CAS number, including other names
4-Cyano-2-nitrophenol, 98% (CAS 3272-08-0) is a chemical reagent available from Chemat. Available pack sizes: 500g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F061530-500G |
| cas | 3272-08-0 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500g | 1736.91 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 25g | 154.13 Pln | |
| Fluorochem | 100g | 424.87 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-hydroxy-3-nitrobenzonitrile (CAS 3272-08-0) is a chemical compound with the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. IUPAC name: 4-hydroxy-3-nitrobenzonitrile. InChIKey: INBLGVOPOSGVTA-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 4-hydroxy-3-nitrobenzonitrile |
| InChIKey | INBLGVOPOSGVTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)[N+](=O)[O-])O |
Computed by PubChem (NCBI)