CAS 86776-50-3 appears in our catalog under these names: 3–Fluoro–4–cyanophenyl 4–ethylbenzoate, 4-Cyano-3-fluorophenyl 4-ethylbenzoate, 98%, 4-Cyano-3-fluorophenyl 4-Ethylbenzoate, >98.0%(GC), 4-Cyano-3-fluorophenyl 4-ethylbenzoate, 98%, 98%. Offered by: GLPBio, Fluorochem, TCI, Chemat. Available pack sizes: 100g, 25g, 10g, 5g.
(4-cyano-3-fluorophenyl) 4-ethylbenzoate (CAS 86776-50-3) is a chemical compound with the molecular formula C16H12FNO2 and a molecular weight of 269.27 g/mol. IUPAC name: (4-cyano-3-fluorophenyl) 4-ethylbenzoate. InChIKey: CDXMJQJMSJCJLU-UHFFFAOYSA-N.
| Molecular formula | C16H12FNO2 |
|---|---|
| Molecular weight | 269.27 g/mol |
| IUPAC name | (4-cyano-3-fluorophenyl) 4-ethylbenzoate |
| InChIKey | CDXMJQJMSJCJLU-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C(=O)OC2=CC(=C(C=C2)C#N)F |
Computed by PubChem (NCBI)