CAS 879479-47-7 is the registry number for 5-Fluoro-1-(2-phenylethyl)-1H-indole-2,3-dione, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 500mg, 50mg.
5-fluoro-1-(2-phenylethyl)indole-2,3-dione (CAS 879479-47-7) is a chemical compound with the molecular formula C16H12FNO2 and a molecular weight of 269.27 g/mol. IUPAC name: 5-fluoro-1-(2-phenylethyl)indole-2,3-dione. InChIKey: FMQVEHDXVCRVTP-UHFFFAOYSA-N.
| Molecular formula | C16H12FNO2 |
|---|---|
| Molecular weight | 269.27 g/mol |
| IUPAC name | 5-fluoro-1-(2-phenylethyl)indole-2,3-dione |
| InChIKey | FMQVEHDXVCRVTP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCN2C3=C(C=C(C=C3)F)C(=O)C2=O |
Computed by PubChem (NCBI)