CAS 226883-79-0 appears in our catalog under these names: FUB-PB-22 3-Carboxyindole Metabolite, FUB–PB–22 3–carboxyindole metabolite, 1-(4-Fluorobenzyl)-1H-indole-3-carboxylic acid, 95%, 95%, FUB-PB-22 3-carboxyindole metabolite, 99.15%, 1-(4-Fluorobenzyl)-1H-indole-3-carboxylic acid, 95%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 50mg, 100mg, 250mg, 1g, 5g.
1-[(4-fluorophenyl)methyl]indole-3-carboxylic acid (CAS 226883-79-0) is a chemical compound with the molecular formula C16H12FNO2 and a molecular weight of 269.27 g/mol. IUPAC name: 1-[(4-fluorophenyl)methyl]indole-3-carboxylic acid. InChIKey: MRLLPLNNVZERDA-UHFFFAOYSA-N.
| Molecular formula | C16H12FNO2 |
|---|---|
| Molecular weight | 269.27 g/mol |
| IUPAC name | 1-[(4-fluorophenyl)methyl]indole-3-carboxylic acid |
| InChIKey | MRLLPLNNVZERDA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2CC3=CC=C(C=C3)F)C(=O)O |
Computed by PubChem (NCBI)