Products 2328072-69-9
CAS 2328072-69-9 appears in our catalog under these names: 5-(4-(Benzyloxy)-3-fluorophenyl)oxazole, 95%, 5-(4-(Benzyloxy)-3-fluorophenyl)oxazole. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
5-(3-fluoro-4-phenylmethoxyphenyl)-1,3-oxazole (CAS 2328072-69-9) is a chemical compound with the molecular formula C16H12FNO2 and a molecular weight of 269.27 g/mol. IUPAC name: 5-(3-fluoro-4-phenylmethoxyphenyl)-1,3-oxazole. InChIKey: NRBXUCQHNNBPDC-UHFFFAOYSA-N.
| Molecular formula | C16H12FNO2 |
|---|---|
| Molecular weight | 269.27 g/mol |
| IUPAC name | 5-(3-fluoro-4-phenylmethoxyphenyl)-1,3-oxazole |
| InChIKey | NRBXUCQHNNBPDC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C3=CN=CO3)F |
Computed by PubChem (NCBI)