Products 943109-61-3
CAS 943109-61-3 appears in our catalog under these names: 1-[(2-Fluorophenyl)methyl]-1h-indole-2-carboxylic acid, 95%, 1-((2-Fluorophenyl)methyl)-1H-indole-2-carboxylic acid, 95%, 1-((2-Fluorophenyl)methyl)-1H-indole-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
1-[(2-fluorophenyl)methyl]indole-2-carboxylic acid (CAS 943109-61-3) is a chemical compound with the molecular formula C16H12FNO2 and a molecular weight of 269.27 g/mol. IUPAC name: 1-[(2-fluorophenyl)methyl]indole-2-carboxylic acid. InChIKey: XYDOYFJXQVZCRB-UHFFFAOYSA-N.
| Molecular formula | C16H12FNO2 |
|---|---|
| Molecular weight | 269.27 g/mol |
| IUPAC name | 1-[(2-fluorophenyl)methyl]indole-2-carboxylic acid |
| InChIKey | XYDOYFJXQVZCRB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2CC3=CC=CC=C3F)C(=O)O |
Computed by PubChem (NCBI)