cas: 50670-50-3 — see every product listed under this CAS number, including other names
4-Cyano-4'-methylbiphenyl, 97% (CAS 50670-50-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F046768-1G |
| cas | 50670-50-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 294.71 Pln | |
| Fluorochem | 25g | 872.63 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-(4-methylphenyl)benzonitrile (CAS 50670-50-3) is a chemical compound with the molecular formula C14H11N and a molecular weight of 193.24 g/mol. IUPAC name: 4-(4-methylphenyl)benzonitrile. InChIKey: QIBWMVSMTSYUSK-UHFFFAOYSA-N.
| Molecular formula | C14H11N |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 4-(4-methylphenyl)benzonitrile |
| InChIKey | QIBWMVSMTSYUSK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)